"""A wrapper over the ``samples`` and ``sample_positions`` collections."""
import re
import time
from datetime import datetime
from enum import Enum, auto
from typing import Any, cast
import pymongo # type: ignore
from bson import ObjectId # type: ignore
from pydantic import BaseModel, ConfigDict, conint
from alab_management.utils.data_objects import get_collection, get_lock
from .sample import Sample, SamplePosition, remove_standalone_sample_position
[docs]
class SamplePositionRequest(BaseModel):
"""
The class is used to request sample position.
You need to specify the prefix of the sample position (will be used to match by `startwith` method) and
the number you request. By default, the number is set to be 1.
"""
# raise error when extra kwargs are passed
model_config = ConfigDict(extra="forbid")
prefix: str
number: conint(ge=0) = 1 # type: ignore
[docs]
@classmethod
def from_str(cls, sample_position_prefix: str) -> "SamplePositionRequest":
"""Create a ``SamplePositionRequest`` from a string."""
return cls(prefix=sample_position_prefix)
[docs]
@classmethod
def from_py_type(cls, sample_position: str | dict[str, Any]):
"""Create a ``SamplePositionRequest`` from a string or a dict."""
if isinstance(sample_position, str):
return cls.from_str(sample_position_prefix=sample_position)
return cls(**sample_position)
[docs]
class SamplePositionStatus(Enum):
"""
The status of a sample position.
- ``EMPTY``: the sample position is neither locked nor occupied
- ``OCCUPIED``: there is a sample in the sample position
- ``LOCKED``: the sample position is reserved by a task
"""
EMPTY = auto()
OCCUPIED = auto()
LOCKED = auto()
POSITION_HISTORY_MAX = 200
def _position_history_entry(
event: str,
position: str | None,
*,
task_id: ObjectId | None = None,
destination: str | None = None,
) -> dict[str, Any]:
"""Build one append-only position_history record."""
entry: dict[str, Any] = {
"at": datetime.now(),
"position": position,
"event": event,
}
if task_id is not None:
entry["task_id"] = task_id
if destination is not None:
entry["destination"] = destination
return entry
def _history_push(entry: dict[str, Any]) -> dict[str, Any]:
"""Mongo ``$push`` clause that caps ``position_history`` length."""
return {
"position_history": {
"$each": [entry],
"$slice": -POSITION_HISTORY_MAX,
}
}
def _sample_from_doc(result: dict[str, Any]) -> Sample:
"""Construct a ``Sample`` from a Mongo document."""
return Sample(
sample_id=result["_id"],
name=result["name"],
position=result["position"],
task_id=result["task_id"],
metadata=result.get("metadata", {}),
tags=result.get("tags", []),
in_transit=result.get("in_transit"),
last_position=result.get("last_position", result.get("position")),
position_history=list(result.get("position_history") or []),
)
[docs]
class SampleView:
"""Sample view manages the samples and their positions."""
def __init__(self):
self._sample_collection = get_collection("samples")
self._sample_positions_collection = get_collection("sample_positions")
self._sample_positions_collection.create_index(
[
(
"name",
pymongo.HASHED,
)
]
)
self._lock = get_lock(self._sample_positions_collection.name)
[docs]
def add_sample_positions_to_db(
self,
sample_positions: list[SamplePosition],
parent_device_name: str | None = None,
):
"""
Insert sample positions info to db, which includes position name and description.
If one sample position's name has already appeared in the database,
we will just skip it.
Args:
sample_positions: some sample position instances
parent_device_name: name of the parent device to these sample_positions.
"""
for sample_pos in sample_positions:
for i in range(sample_pos.number):
# we use <name><SEPARATOR><number> format to create multiple sample positions
# if there is only one sample position (sample_position.number == 1)
# the name of sample position will be directly used as the sample position's name in the database
name = (
f"{sample_pos.name}{SamplePosition.SEPARATOR}{i+1}" # index from 1
if sample_pos.number != 1
else sample_pos.name
)
if parent_device_name:
name = f"{parent_device_name}{SamplePosition.SEPARATOR}{name}"
if re.search(r"[$.]", name) is not None:
raise ValueError(
f"Unsupported sample position name: {name}. "
f"Sample position name should not contain '.' or '$'"
)
sample_pos_ = self._sample_positions_collection.find_one({"name": name})
if sample_pos_ is None:
new_entry = {
"name": name,
"description": sample_pos.description,
"task_id": None,
"last_updated": datetime.now(),
}
if parent_device_name:
new_entry["parent_device"] = parent_device_name
self._sample_positions_collection.insert_one(new_entry)
[docs]
def clean_up_sample_position_collection(self):
"""Drop the sample position collection."""
self._sample_positions_collection.drop()
[docs]
def request_sample_positions(
self,
task_id: ObjectId,
sample_positions: list[SamplePositionRequest | str | dict[str, Any]],
exact_positions: set[str] | None = None,
) -> dict[str, list[dict[str, Any]]] | None:
"""
Request a list of sample positions, this function will return until all the sample positions are available.
Args:
task_id: the task id that requests these resources
sample_positions: the list of sample positions, which is requested by their names.
The sample position name is actually the prefix of a sample position, which we
will try to match all the sample positions will the name
exact_positions: Set of position names that should be matched exactly (not by prefix).
If None, all positions use prefix matching (default behavior).
"""
if exact_positions is None:
exact_positions = set()
sample_positions_request: list[SamplePositionRequest] = [
(
SamplePositionRequest.from_py_type(sample_position)
if not isinstance(sample_position, SamplePositionRequest)
else sample_position
)
for sample_position in sample_positions
]
if len(sample_positions_request) != len(
{sample_position.prefix for sample_position in sample_positions_request}
):
raise ValueError("Duplicated sample_positions in one request.")
# check if there are enough positions
for sample_position in sample_positions_request:
is_exact = sample_position.prefix in exact_positions
if is_exact:
# For exact match, only number=1 makes sense (can't have multiple positions with same exact name)
if sample_position.number > 1:
raise ValueError(
f"Exact position matching can only be used with number=1. "
f"Position `{sample_position.prefix}` requests {sample_position.number} positions, "
f"but exact matching only works for a single position."
)
# For exact match, check if the position exists
count = self._sample_positions_collection.count_documents(
{"name": sample_position.prefix}
)
else:
# For prefix match, count all matching positions
count = self._sample_positions_collection.count_documents(
{"name": {"$regex": f"^{re.escape(sample_position.prefix)}"}}
)
if count < sample_position.number:
match_type = "exact" if is_exact else "prefix"
raise ValueError(
f"Position {match_type} `{sample_position.prefix}` can only "
f"have {count} matches, but requests {sample_position.number}"
)
with self._lock(): # pylint: disable=not-callable
available_positions: dict[str, list[dict[str, str | bool]]] = {}
for sample_position in sample_positions_request:
is_exact = sample_position.prefix in exact_positions
result = self.get_available_sample_position(
task_id,
position_prefix=sample_position.prefix,
exact_match=is_exact,
)
if not result or len(result) < sample_position.number:
return None
# we try to choose the position that has already been locked by this task
available_positions[sample_position.prefix] = sorted(
result, key=lambda task: int(task["need_release"])
)[: sample_position.number]
return available_positions
[docs]
def get_sample_position(self, position: str) -> dict[str, Any] | None:
"""
Get the sample position entry in the database.
if the position is not a valid position (not defined in the database), return None
"""
return self._sample_positions_collection.find_one({"name": position})
[docs]
def get_sample_position_status(
self, position: str
) -> tuple[SamplePositionStatus, ObjectId | None]:
"""
Get the status of a sample position.
If there is a sample in the position, return OCCUPIED;
else if the sample position is locked by a task, return LOCKED;
return EMPTY
Args:
position: the name of the sample position
Returns
-------
if the position is occupied by a sample, return OCCUPIED and the task id of the sample
if the position is locked by a task, return LOCKED and the task id
else, return EMPTY and None
"""
sample_position = self.get_sample_position(position=position)
if sample_position is None:
raise ValueError(f"Invalid sample position: {position}")
sample = self._sample_collection.find_one({"position": position})
if sample is not None:
return SamplePositionStatus.OCCUPIED, sample["task_id"]
if sample_position["task_id"] is not None:
return SamplePositionStatus.LOCKED, sample_position["task_id"]
return SamplePositionStatus.EMPTY, None
[docs]
def get_sample_position_parent_device(self, position: str) -> str | None:
"""
Get the parent device of a sample position.
If no parent device is defined, returns None. If the
"position" query is a prefix, will look for a single parent device across all matched positions (ie a query
for position="furnace_1/tray" will properly return "furnace_1" even if "furnace_1/tray/1" and
"furnace_1/tray/2" are in the database _as long as "furnace_1" is the parent device of both!_).
"""
sample_positions = self._sample_positions_collection.find(
{"name": {"$regex": f"^{position}"}}
)
parent_devices = list({sp.get("parent_device") for sp in sample_positions})
if len(parent_devices) == 0:
raise ValueError(f"No sample position(s) beginning with: {position}")
elif len(parent_devices) > 1:
raise Exception(
f"Multiple parent devices ({parent_devices}) found for sample positions found beginning with: "
f'"position". Make a more specific position query that doesn\'t match multiple devices!'
)
return parent_devices[0]
[docs]
def is_unoccupied_position(self, position: str) -> bool:
"""Tell if a sample position is unoccupied or not."""
return (
self.get_sample_position_status(position)[0]
is not SamplePositionStatus.OCCUPIED
)
[docs]
def is_locked_position(self, position: str) -> bool:
"""Tell if a sample position is locked or not."""
sample_position = self.get_sample_position(position=position)
if sample_position is None:
raise ValueError(f"Invalid sample position: {position}")
return sample_position["task_id"] is not None
[docs]
def is_blocked_position(self, position: str) -> bool:
"""True when the position is operator-blocked from automated allocation."""
sample_position = self.get_sample_position(position=position)
if sample_position is None:
raise ValueError(f"Invalid sample position: {position}")
return bool(sample_position.get("blocked"))
def _require_unlocked_for_block_toggle(self, position: str) -> dict[str, Any]:
sample_position = self.get_sample_position(position=position)
if sample_position is None:
raise ValueError(f"Invalid sample position: {position}")
if sample_position.get("task_id") is not None:
raise ValueError(
"Position is locked by a task; release the lock before changing "
"block state."
)
return sample_position
[docs]
def block_sample_position(
self, position: str, reason: str | None = None
) -> None:
"""Mark a sample position blocked so automation will not assign it.
Rejects when the position has an active task lock. Lab idle is not required.
"""
self._require_unlocked_for_block_toggle(position)
reason_text = (reason or "").strip() or None
self._sample_positions_collection.update_one(
{"name": position},
{
"$set": {
"blocked": True,
"blocked_reason": reason_text,
"blocked_at": datetime.now(),
}
},
)
[docs]
def unblock_sample_position(self, position: str) -> None:
"""Clear the operator block on a sample position.
Rejects when the position has an active task lock.
"""
self._require_unlocked_for_block_toggle(position)
self._sample_positions_collection.update_one(
{"name": position},
{
"$set": {
"blocked": False,
"blocked_reason": None,
"blocked_at": None,
}
},
)
[docs]
def unblock_all_sample_positions(self) -> int:
"""Clear ``blocked`` on every sample position. Returns how many were updated.
Does not touch task locks or sample occupancy. Positions that are currently
task-locked remain locked but become unblocked for after the lock is released.
"""
result = self._sample_positions_collection.update_many(
{"blocked": True},
{
"$set": {
"blocked": False,
"blocked_reason": None,
"blocked_at": None,
}
},
)
return int(result.modified_count)
[docs]
def get_available_sample_position(
self, task_id: ObjectId, position_prefix: str, exact_match: bool = False
) -> list[dict[str, str | bool]]:
"""
Check if the position is occupied.
The structure of returned list is ``{"name": str, "need_release": bool}``.
The entry need_release indicates whether a sample position needs to be released
when __exit__ method is called in the ``SamplePositionsLock``.
Args:
task_id: The task ID requesting the position
position_prefix: The position name or prefix to match
exact_match: If True, match the exact position name. If False, use prefix matching.
"""
query = {"name": position_prefix} if exact_match else {"name": {"$regex": f"^{re.escape(position_prefix)}"}}
if self._sample_positions_collection.find_one(query) is None:
if exact_match:
raise ValueError(f"Cannot find sample position: {position_prefix}")
else:
raise ValueError(f"Cannot find device with prefix: {position_prefix}")
available_sample_positions = self._sample_positions_collection.find(
{
**query,
"$or": [
{
"task_id": None,
},
{
"task_id": task_id,
},
],
}
)
available_sp_names = []
for sample_position in available_sample_positions:
if sample_position.get("blocked"):
continue
status, current_task_id = self.get_sample_position_status(
sample_position["name"]
)
if status is SamplePositionStatus.EMPTY or task_id == current_task_id:
available_sp_names.append(
{
"name": sample_position["name"],
"need_release": self.get_sample_position(sample_position["name"])["task_id"] != task_id, # type: ignore
}
)
return available_sp_names
[docs]
def diagnose_sample_position_shortage(
self,
task_id: ObjectId,
sample_positions: list[SamplePositionRequest | str | dict[str, Any]],
exact_positions: set[str] | None = None,
) -> dict[str, Any]:
"""Explain why ``request_sample_positions`` would return ``None``.
Returns a structured diagnosis suitable for operator prompts:
- ``shortages``: per-request need/available plus blocker positions
- ``allow_clear``: True only when every shortage is an exact-slot request
(safe to clear those specific slots from User Input)
- ``clearable_blockers``: blockers for exact shortages (for Clear action)
- ``blocked_blockers``: unique positions with ``blocked`` across shortages
- ``allow_unblock_blocked``: True when any shortage is caused by blocked slots
"""
if exact_positions is None:
exact_positions = set()
sample_positions_request: list[SamplePositionRequest] = [
(
SamplePositionRequest.from_py_type(sample_position)
if not isinstance(sample_position, SamplePositionRequest)
else sample_position
)
for sample_position in sample_positions
]
shortages: list[dict[str, Any]] = []
for sample_position in sample_positions_request:
is_exact = sample_position.prefix in exact_positions
available = self.get_available_sample_position(
task_id,
position_prefix=sample_position.prefix,
exact_match=is_exact,
)
needed = int(sample_position.number)
if len(available) >= needed:
continue
query = (
{"name": sample_position.prefix}
if is_exact
else {
"name": {
"$regex": f"^{re.escape(sample_position.prefix)}"
}
}
)
blockers: list[dict[str, Any]] = []
for sample_position_doc in self._sample_positions_collection.find(query):
position_name = sample_position_doc["name"]
if sample_position_doc.get("blocked"):
blockers.append(
{
"position": position_name,
"reason": "BLOCKED",
"sample_id": None,
"sample_name": None,
"task_id": None,
"blocked_reason": sample_position_doc.get(
"blocked_reason"
),
}
)
continue
status, current_task_id = self.get_sample_position_status(
position_name
)
if status is SamplePositionStatus.EMPTY or task_id == current_task_id:
continue
blocker: dict[str, Any] = {
"position": position_name,
"reason": status.name,
"sample_id": None,
"sample_name": None,
"task_id": str(current_task_id) if current_task_id else None,
}
if status is SamplePositionStatus.OCCUPIED:
sample = self._sample_collection.find_one(
{"position": position_name}
)
if sample is not None:
blocker["sample_id"] = str(sample["_id"])
blocker["sample_name"] = sample.get("name")
blockers.append(blocker)
shortages.append(
{
"prefix": sample_position.prefix,
"exact": is_exact,
"needed": needed,
"available": len(available),
"blockers": blockers,
}
)
allow_clear = bool(shortages) and all(
shortage["exact"] for shortage in shortages
)
clearable_blockers: list[dict[str, Any]] = []
if allow_clear:
seen: set[str] = set()
for shortage in shortages:
for blocker in shortage["blockers"]:
if blocker.get("reason") == "BLOCKED":
continue
position_name = blocker["position"]
if position_name in seen:
continue
seen.add(position_name)
clearable_blockers.append(blocker)
blocked_blockers: list[dict[str, Any]] = []
blocked_seen: set[str] = set()
for shortage in shortages:
for blocker in shortage["blockers"]:
if blocker.get("reason") != "BLOCKED":
continue
position_name = blocker["position"]
if position_name in blocked_seen:
continue
blocked_seen.add(position_name)
blocked_blockers.append(blocker)
return {
"shortages": shortages,
"allow_clear": allow_clear,
"clearable_blockers": clearable_blockers,
"blocked_blockers": blocked_blockers,
"allow_unblock_blocked": bool(blocked_blockers),
}
[docs]
def lock_sample_position(self, task_id: ObjectId, position: str):
"""Lock a sample position."""
sample_status, current_task_id = self.get_sample_position_status(position)
if current_task_id != task_id:
if sample_status is SamplePositionStatus.OCCUPIED:
raise ValueError(f"Position ({position}) is currently occupied")
if sample_status is SamplePositionStatus.LOCKED:
raise ValueError(
f"Position is currently locked by task: {current_task_id}"
)
self._sample_positions_collection.update_one(
{"name": position},
{
"$set": {
"task_id": task_id,
}
},
)
# Wait until the position is locked successfully
while not self.is_locked_position(position):
time.sleep(0.5)
[docs]
def release_sample_position(self, position: str):
"""Unlock a sample position."""
if self.get_sample_position(position) is None:
raise ValueError(f"Invalid sample position: {position}")
self._sample_positions_collection.update_one(
{"name": position},
{
"$set": {
"task_id": None,
}
},
)
# Wait until the position is released successfully
while self.is_locked_position(position):
time.sleep(0.5)
[docs]
def get_sample_positions_by_task(self, task_id: ObjectId | None) -> list[str]:
"""Get the list of sample positions that is locked by a task (given task id)."""
return [
sample_position["name"]
for sample_position in self._sample_positions_collection.find(
{"task_id": task_id}
)
]
#################################################################
# operations related to samples #
#################################################################
[docs]
def create_sample(
self,
name: str,
position: str | None = None,
sample_id: ObjectId | None = None,
tags: list[str] | None = None,
metadata: dict[str, Any] | None = None,
) -> ObjectId:
"""
Create a sample and return its uid in the database.
Samples with the same name can exist in the database
"""
if position is not None and not self.is_unoccupied_position(position):
# Wait a bit to see if it is actually locked
for _ in range(5):
time.sleep(1)
if self.is_unoccupied_position(position):
break
if not self.is_unoccupied_position(position):
raise ValueError(f"Requested position ({position}) is not EMPTY.")
if re.search(r"[.$]", name) is not None:
raise ValueError(
f"Unsupported sample name: {name}. "
f"Sample name should not contain '.' or '$'"
)
now = datetime.now()
history: list[dict[str, Any]] = []
if position is not None:
history.append(_position_history_entry("placed", position))
entry = {
"name": name,
"tags": tags or [],
"metadata": metadata or {},
"position": position,
"last_position": position,
"task_id": None,
"in_transit": None,
"position_history": history,
"created_at": now,
"last_updated": now,
}
if sample_id:
if not isinstance(sample_id, ObjectId):
raise ValueError(
f"User provided {sample_id} as the sample_id -- this is not a valid ObjectId, so this sample "
f"cannot be created in the database!"
)
entry["_id"] = sample_id
result = self._sample_collection.insert_one(entry)
# Wait until the sample is created
while not self.exists(result.inserted_id):
time.sleep(0.5)
return cast(ObjectId, result.inserted_id)
[docs]
def get_sample(self, sample_id: ObjectId) -> Sample:
"""Get a sample by its id.
Args:
sample_id (ObjectId): id of the sample within sample collection
Raises
------
ValueError: no sample found with given id
Returns
-------
Sample: Sample object for given id
"""
result = self._sample_collection.find_one({"_id": sample_id})
if result is None:
raise ValueError(f"No sample found with id: {sample_id}")
return _sample_from_doc(result)
[docs]
def update_sample_task_id(self, sample_id: ObjectId, task_id: ObjectId | None):
"""Update the task id for a sample."""
result = self._sample_collection.find_one({"_id": sample_id})
if result is None:
raise ValueError(f"Cannot find sample with id: {sample_id}")
self._sample_collection.update_one(
{"_id": sample_id},
{
"$set": {
"task_id": task_id,
"last_updated": datetime.now(),
}
},
)
[docs]
def move_sample(self, sample_id: ObjectId, position: str | None):
"""Update the sample with new position.
A successful move also clears any ``in_transit`` record, since the sample has arrived at a
well-defined position.
"""
result = self._sample_collection.find_one({"_id": sample_id})
if result is None:
raise ValueError(f"Cannot find sample with id: {sample_id}")
if result["position"] == position:
# Position unchanged, but the sample is now at rest: clear any stale in-transit record.
if result.get("in_transit") is not None:
self._sample_collection.update_one(
{"_id": sample_id},
{"$set": {"in_transit": None, "last_updated": datetime.now()}},
)
return
if position is not None and not self.is_unoccupied_position(position):
# Wait a bit to see if it is actually locked
for _ in range(5):
time.sleep(1)
if self.is_unoccupied_position(position):
break
if not self.is_unoccupied_position(position):
raise ValueError(
f"Requested position ({position}) is not EMPTY or LOCKED by other task."
)
update_fields = {
"position": position,
"in_transit": None,
"last_updated": datetime.now(),
}
# Keep last_position as the most recent *known* location: only update it when moving to a
# real position. When position becomes None (sample left the lab/position), retain the
# previous last_position so the "last known location" is never empty.
if position is not None:
update_fields["last_position"] = position
event = "cleared" if position is None else "moved"
self._sample_collection.update_one(
{"_id": sample_id},
{
"$set": update_fields,
"$push": _history_push(
_position_history_entry(
event,
position if position is not None else result.get("position"),
task_id=result.get("task_id"),
)
),
},
)
[docs]
def set_sample_in_transit(
self, sample_id: ObjectId, source: str | None, destination: str | None
):
"""Mark a sample as being physically moved from ``source`` to ``destination``.
This is meant to be called right before a robot move begins. It does NOT change the
recorded ``position`` (the sample is still physically at/near ``source`` until the move
completes). If the move crashes mid-transfer, this record persists, so the last known
position plus the intended destination remain visible. ``move_sample`` clears it once the
sample arrives.
"""
result = self._sample_collection.find_one({"_id": sample_id})
if result is None:
raise ValueError(f"Cannot find sample with id: {sample_id}")
update_fields = {
"in_transit": {
"source": source,
"destination": destination,
"started_at": datetime.now(),
},
"last_updated": datetime.now(),
}
# The sample is physically still at/near the source until the move completes, so record the
# source as the last known location.
if source is not None:
update_fields["last_position"] = source
self._sample_collection.update_one(
{"_id": sample_id},
{
"$set": update_fields,
"$push": _history_push(
_position_history_entry(
"in_transit",
source,
task_id=result.get("task_id"),
destination=destination,
)
),
},
)
[docs]
def clear_sample_in_transit(self, sample_id: ObjectId):
"""Clear the in-transit record for a sample (e.g. for manual recovery)."""
result = self._sample_collection.find_one({"_id": sample_id})
if result is None:
raise ValueError(f"Cannot find sample with id: {sample_id}")
self._sample_collection.update_one(
{"_id": sample_id},
{"$set": {"in_transit": None, "last_updated": datetime.now()}},
)
[docs]
def get_in_transit_samples(self) -> list[dict[str, Any]]:
"""Return summary info for all samples currently recorded as in transit."""
in_transit_samples = []
for sample in self._sample_collection.find({"in_transit": {"$ne": None}}):
transit = sample.get("in_transit") or {}
in_transit_samples.append(
{
"sample_id": sample["_id"],
"name": sample["name"],
"position": sample["position"],
"last_position": sample.get("last_position", sample.get("position")),
"task_id": sample.get("task_id"),
"source": transit.get("source"),
"destination": transit.get("destination"),
"started_at": transit.get("started_at"),
}
)
return in_transit_samples
[docs]
def get_sample_positions_names_by_device(self, device_name: str) -> list[str]:
"""Get all the sample positions names that are related to a device."""
return [
sample_position["name"]
for sample_position in self._sample_positions_collection.find(
{"parent_device": device_name}
)
]
[docs]
def get_samples_on_device(self, device_name: str) -> dict[str, list[ObjectId]]:
"""Get all the samples on a device."""
samples = self._sample_collection.find(
{"position": {"$regex": f"^{device_name}{SamplePosition.SEPARATOR}"}}
)
all_samples = {}
for sample in samples:
# remove the suffix of the sample position (e.g. remove /1, /2, etc.)
position_name = re.sub(
f"{SamplePosition.SEPARATOR}\\d+$", "", sample["position"]
)
all_samples.setdefault(position_name, []).append(sample["_id"])
return all_samples
[docs]
def exists(self, sample_id: ObjectId | str) -> bool:
"""Check if a sample exists in the database.
Args:
sample_id (ObjectId): id of the sample within sample collection
Returns
-------
bool: True if sample exists in the database
"""
return self._sample_collection.count_documents({"_id": ObjectId(sample_id)}) > 0
[docs]
def remove_sample_position_by_prefix(self, prefix: str):
"""Remove a sample position from the database."""
with self._lock(): # pylint: disable=not-callable
remove_standalone_sample_position(prefix)
self._sample_positions_collection.delete_many(
{"name": {"$regex": f"^{re.escape(prefix)}"}}
)
[docs]
def get_sample_positions_names_by_prefix(self, prefix: str) -> list[str]:
"""Get all the sample positions names that are related to a device."""
return [
sample_position["name"]
for sample_position in self._sample_positions_collection.find(
{"name": {"$regex": f"^{re.escape(prefix)}"}}
)
]
[docs]
def get_all_sample_positions_from_db(self) -> dict[str, dict[str, Any]]:
"""
Get all sample positions from the database directly.
Returns a dictionary mapping position names to their database entries.
This includes both standalone and device-associated sample positions.
"""
sample_positions = {}
for position_doc in self._sample_positions_collection.find():
sample_positions[position_doc["name"]] = position_doc
return sample_positions
[docs]
def get_sample_position_max_number_by_prefix(self, prefix: str) -> int:
"""
Get the maximum number of sample positions for a given prefix from the database.
Args:
prefix: The prefix to search for (e.g., "furnace_temp")
Returns
-------
The maximum number found for positions with this prefix
"""
positions = self._sample_positions_collection.find(
{"name": {"$regex": f"^{re.escape(prefix)}"}}
)
max_number = 0
for position in positions:
# Extract number from position name (e.g., "furnace_temp/1" -> 1)
name = position["name"]
try:
number_part = name.split(SamplePosition.SEPARATOR)[-1]
number = int(number_part)
max_number = max(max_number, number)
except (ValueError, IndexError):
# If we can't parse the number, count this as position 1
max_number = max(max_number, 1)
return max_number
[docs]
def get_sample_name_by_position(self, position: str) -> str | None:
"""
Get the sample name at a given position.
Args:
position: The position to search for
Returns
-------
The sample name if a sample exists at the position, None otherwise
"""
sample = self._sample_collection.find_one({"position": position})
return sample["name"] if sample else None
[docs]
def get_sample_by_position(self, position: str) -> Sample | None:
"""
Get the sample object at a given position.
Args:
position: The position to search for
Returns
-------
The Sample object if a sample exists at the position, None otherwise
"""
sample = self._sample_collection.find_one({"position": position})
if sample is None:
return None
return _sample_from_doc(sample)